C24H25N3O — CID 66528595
3-(1H-benzimidazol-2-yl)-N-[(4-phenylmethoxyphenyl)methyl]propan-1-amine (PubChem CID 66528595) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[(4-phenylmethoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[(4-phenylmethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 66528595 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[(4-phenylmethoxyphenyl)methyl]propan-1-amine |
| SMILES | c1ccc(COc2ccc(CNCCCc3nc4ccccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O/c1-2-7-20(8-3-1)18-28-21-14-12-19(13-15-21)17-25-16-6-11-24-26-22-9-4-5-10-23(22)27-24/h1-5,7-10,12-15,25H,6,11,16-18H2,(H,26,27) |
| InChIKey | FBEBPLSHGKEOOR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|