C24H23Cl2N3O — CID 66529031
3-(1H-benzimidazol-2-yl)-N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 66529031) has the molecular formula C24H23Cl2N3O and a molecular weight of 440.37 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66529031 |
| Molecular Formula | C24H23Cl2N3O |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | Clc1ccc(COc2ccc(CNCCCc3nc4ccccc4[nH]3)cc2)cc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O/c25-20-12-9-18(14-21(20)26)16-30-19-10-7-17(8-11-19)15-27-13-3-6-24-28-22-4-1-2-5-23(22)29-24/h1-2,4-5,7-12,14,27H,3,6,13,15-16H2,(H,28,29) |
| InChIKey | ZIKXJTGIWFNTMD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|