C20H23Cl2N3O — CID 66529083
3-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-4-propan-2-yloxyphenyl)methyl]propan-1-amine (PubChem CID 66529083) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-4-propan-2-yloxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-4-propan-2-yloxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 66529083 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-4-propan-2-yloxyphenyl)methyl]propan-1-amine |
| SMILES | CC(C)Oc1c(Cl)cc(CNCCCc2nc3ccccc3[nH]2)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O/c1-13(2)26-20-15(21)10-14(11-16(20)22)12-23-9-5-8-19-24-17-6-3-4-7-18(17)25-19/h3-4,6-7,10-11,13,23H,5,8-9,12H2,1-2H3,(H,24,25) |
| InChIKey | WIODHICKTSYENV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|