C19H21Cl2N3O — CID 66529012
3-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-4-ethoxyphenyl)methyl]propan-1-amine (PubChem CID 66529012) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-4-ethoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-4-ethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 66529012 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-4-ethoxyphenyl)methyl]propan-1-amine |
| SMILES | CCOc1c(Cl)cc(CNCCCc2nc3ccccc3[nH]2)cc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O/c1-2-25-19-14(20)10-13(11-15(19)21)12-22-9-5-8-18-23-16-6-3-4-7-17(16)24-18/h3-4,6-7,10-11,22H,2,5,8-9,12H2,1H3,(H,23,24) |
| InChIKey | CMERFVQTMBLIFA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|