C17H17Cl2N3O — CID 66526850
2-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-2-methoxyphenyl)methyl]ethanamine (PubChem CID 66526850) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-2-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-2-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 66526850 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N-[(3,5-dichloro-2-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1c(Cl)cc(Cl)cc1CNCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H17Cl2N3O/c1-23-17-11(8-12(18)9-13(17)19)10-20-7-6-16-21-14-4-2-3-5-15(14)22-16/h2-5,8-9,20H,6-7,10H2,1H3,(H,21,22) |
| InChIKey | SEJCTCRAOKTBGY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|