C20H24BrN3O2 — CID 66527310
2-(1H-benzimidazol-2-yl)-N-[(5-bromo-3-methoxy-2-propan-2-yloxyphenyl)methyl]ethanamine (PubChem CID 66527310) has the molecular formula C20H24BrN3O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N-[(5-bromo-3-methoxy-2-propan-2-yloxyphenyl)methyl]ethanamine.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N-[(5-bromo-3-methoxy-2-propan-2-yloxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 66527310 |
| Molecular Formula | C20H24BrN3O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N-[(5-bromo-3-methoxy-2-propan-2-yloxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(Br)cc(CNCCc2nc3ccccc3[nH]2)c1OC(C)C |
| InChI | InChI=1S/C20H24BrN3O2/c1-13(2)26-20-14(10-15(21)11-18(20)25-3)12-22-9-8-19-23-16-6-4-5-7-17(16)24-19/h4-7,10-11,13,22H,8-9,12H2,1-3H3,(H,23,24) |
| InChIKey | YVCBCMGXMUGDOD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|