C16H16BrN3 — CID 66526967
2-(1H-benzimidazol-2-yl)-N-[(3-bromophenyl)methyl]ethanamine (PubChem CID 66526967) has the molecular formula C16H16BrN3 and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N-[(3-bromophenyl)methyl]ethanamine.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N-[(3-bromophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 66526967 |
| Molecular Formula | C16H16BrN3 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N-[(3-bromophenyl)methyl]ethanamine |
| SMILES | Brc1cccc(CNCCc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C16H16BrN3/c17-13-5-3-4-12(10-13)11-18-9-8-16-19-14-6-1-2-7-15(14)20-16/h1-7,10,18H,8-9,11H2,(H,19,20) |
| InChIKey | NVDAJLOAXOINIA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|