C20H26N4 — CID 124824368
4-[[2-(1H-benzimidazol-2-yl)ethylamino]methyl]-N,N-diethylaniline (PubChem CID 124824368) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is 4-[[2-(1H-benzimidazol-2-yl)ethylamino]methyl]-N,N-diethylaniline.
| Compound Name | 4-[[2-(1H-benzimidazol-2-yl)ethylamino]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 124824368 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 4-[[2-(1H-benzimidazol-2-yl)ethylamino]methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CNCCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C20H26N4/c1-3-24(4-2)17-11-9-16(10-12-17)15-21-14-13-20-22-18-7-5-6-8-19(18)23-20/h5-12,21H,3-4,13-15H2,1-2H3,(H,22,23) |
| InChIKey | IJJCZLKFAGLKKJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|