C15H23N5 — CID 64546177
N,N-diethyl-4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline (PubChem CID 64546177) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline.
| Compound Name | N,N-diethyl-4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 64546177 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | N,N-diethyl-4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline |
| SMILES | CCN(CC)c1ccc(CNCCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C15H23N5/c1-3-20(4-2)14-7-5-13(6-8-14)11-16-10-9-15-17-12-18-19-15/h5-8,12,16H,3-4,9-11H2,1-2H3,(H,17,18,19) |
| InChIKey | PJWVVNNKUUZLGF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|