C13H19N5 — CID 64546774
N,N-dimethyl-4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline (PubChem CID 64546774) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is N,N-dimethyl-4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline.
| Compound Name | N,N-dimethyl-4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 64546774 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N,N-dimethyl-4-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline |
| SMILES | CN(C)c1ccc(CNCCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C13H19N5/c1-18(2)12-5-3-11(4-6-12)9-14-8-7-13-15-10-16-17-13/h3-6,10,14H,7-9H2,1-2H3,(H,15,16,17) |
| InChIKey | AIDXMKZQCTWUSM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|