C17H23Cl2FN2 — CID 17123265
4-[[2-(4-fluorophenyl)ethylamino]methyl]-N,N-dimethylaniline;dihydrochloride (PubChem CID 17123265) has the molecular formula C17H23Cl2FN2 and a molecular weight of 345.29 g/mol. Its IUPAC name is 4-[[2-(4-fluorophenyl)ethylamino]methyl]-N,N-dimethylaniline;dihydrochloride.
| Compound Name | 4-[[2-(4-fluorophenyl)ethylamino]methyl]-N,N-dimethylaniline;dihydrochloride |
|---|---|
| PubChem CID | 17123265 |
| Molecular Formula | C17H23Cl2FN2 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-[[2-(4-fluorophenyl)ethylamino]methyl]-N,N-dimethylaniline;dihydrochloride |
| SMILES | CN(C)c1ccc(CNCCc2ccc(F)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C17H21FN2.2ClH/c1-20(2)17-9-5-15(6-10-17)13-19-12-11-14-3-7-16(18)8-4-14;;/h3-10,19H,11-13H2,1-2H3;2*1H |
| InChIKey | RKLSPWRTYHYVKC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|