C13H19F3N2 — CID 79039488
N,N-dimethyl-4-[(4,4,4-trifluorobutylamino)methyl]aniline (PubChem CID 79039488) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N,N-dimethyl-4-[(4,4,4-trifluorobutylamino)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[(4,4,4-trifluorobutylamino)methyl]aniline |
|---|---|
| PubChem CID | 79039488 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N,N-dimethyl-4-[(4,4,4-trifluorobutylamino)methyl]aniline |
| SMILES | CN(C)c1ccc(CNCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H19F3N2/c1-18(2)12-6-4-11(5-7-12)10-17-9-3-8-13(14,15)16/h4-7,17H,3,8-10H2,1-2H3 |
| InChIKey | PCIZYQNNLBJFOS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|