C14H25ClN2 — CID 17290940
N,N-dimethyl-4-[(pentylamino)methyl]aniline;hydrochloride (PubChem CID 17290940) has the molecular formula C14H25ClN2 and a molecular weight of 256.82 g/mol. Its IUPAC name is N,N-dimethyl-4-[(pentylamino)methyl]aniline;hydrochloride.
| Compound Name | N,N-dimethyl-4-[(pentylamino)methyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 17290940 |
| Molecular Formula | C14H25ClN2 |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N,N-dimethyl-4-[(pentylamino)methyl]aniline;hydrochloride |
| SMILES | CCCCCNCc1ccc(N(C)C)cc1.Cl |
| InChI | InChI=1S/C14H24N2.ClH/c1-4-5-6-11-15-12-13-7-9-14(10-8-13)16(2)3;/h7-10,15H,4-6,11-12H2,1-3H3;1H |
| InChIKey | XQNNECPXWRVTOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|