C26H42N4 — CID 3029601
N,N'-bis[[4-(dimethylamino)phenyl]methyl]octane-1,8-diamine (PubChem CID 3029601) has the molecular formula C26H42N4 and a molecular weight of 410.65 g/mol. Its IUPAC name is N,N'-bis[[4-(dimethylamino)phenyl]methyl]octane-1,8-diamine.
| Compound Name | N,N'-bis[[4-(dimethylamino)phenyl]methyl]octane-1,8-diamine |
|---|---|
| PubChem CID | 3029601 |
| Molecular Formula | C26H42N4 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | N,N'-bis[[4-(dimethylamino)phenyl]methyl]octane-1,8-diamine |
| SMILES | CN(C)c1ccc(CNCCCCCCCCNCc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H42N4/c1-29(2)25-15-11-23(12-16-25)21-27-19-9-7-5-6-8-10-20-28-22-24-13-17-26(18-14-24)30(3)4/h11-18,27-28H,5-10,19-22H2,1-4H3 |
| InChIKey | ONEZUWUYAHNRMZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|