C19H32N4O3 — CID 11562024
N-[4-[[4-(dimethylamino)phenyl]methylamino]butyl]-N'-hydroxyhexanediamide (PubChem CID 11562024) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)phenyl]methylamino]butyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[4-[[4-(dimethylamino)phenyl]methylamino]butyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 11562024 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-[4-[[4-(dimethylamino)phenyl]methylamino]butyl]-N'-hydroxyhexanediamide |
| SMILES | CN(C)c1ccc(CNCCCCNC(=O)CCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C19H32N4O3/c1-23(2)17-11-9-16(10-12-17)15-20-13-5-6-14-21-18(24)7-3-4-8-19(25)22-26/h9-12,20,26H,3-8,13-15H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | SPNQTYGAZJBXCR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|