C27H50Br2N4O3 — CID 24854578
N-[3-[4-[(4-tert-butylphenyl)methylamino]butylamino]propyl]-N'-hydroxynonanediamide;dihydrobromide (PubChem CID 24854578) has the molecular formula C27H50Br2N4O3 and a molecular weight of 638.53 g/mol. Its IUPAC name is N-[3-[4-[(4-tert-butylphenyl)methylamino]butylamino]propyl]-N'-hydroxynonanediamide;dihydrobromide.
| Compound Name | N-[3-[4-[(4-tert-butylphenyl)methylamino]butylamino]propyl]-N'-hydroxynonanediamide;dihydrobromide |
|---|---|
| PubChem CID | 24854578 |
| Molecular Formula | C27H50Br2N4O3 |
| Molecular Weight | 638.53 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | N-[3-[4-[(4-tert-butylphenyl)methylamino]butylamino]propyl]-N'-hydroxynonanediamide;dihydrobromide |
| SMILES | Br.Br.CC(C)(C)c1ccc(CNCCCCNCCCNC(=O)CCCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C27H48N4O3.2BrH/c1-27(2,3)24-16-14-23(15-17-24)22-29-19-10-9-18-28-20-11-21-30-25(32)12-7-5-4-6-8-13-26(33)31-34;;/h14-17,28-29,34H,4-13,18-22H2,1-3H3,(H,30,32)(H,31,33);2*1H |
| InChIKey | MKIVFZCALALCIP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|