C18H31ClN2O — CID 119501450
5-(4-tert-butylphenyl)-N-[2-(methylamino)ethyl]pentanamide;hydrochloride (PubChem CID 119501450) has the molecular formula C18H31ClN2O and a molecular weight of 326.91 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-N-[2-(methylamino)ethyl]pentanamide;hydrochloride.
| Compound Name | 5-(4-tert-butylphenyl)-N-[2-(methylamino)ethyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119501450 |
| Molecular Formula | C18H31ClN2O |
| Molecular Weight | 326.91 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 5-(4-tert-butylphenyl)-N-[2-(methylamino)ethyl]pentanamide;hydrochloride |
| SMILES | CNCCNC(=O)CCCCc1ccc(C(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C18H30N2O.ClH/c1-18(2,3)16-11-9-15(10-12-16)7-5-6-8-17(21)20-14-13-19-4;/h9-12,19H,5-8,13-14H2,1-4H3,(H,20,21);1H |
| InChIKey | CBPMMADSIQLSLW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|