C16H26N2O — CID 119500998
3-(4-tert-butylphenyl)-N-[2-(methylamino)ethyl]propanamide (PubChem CID 119500998) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[2-(methylamino)ethyl]propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[2-(methylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 119500998 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[2-(methylamino)ethyl]propanamide |
| SMILES | CNCCNC(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O/c1-16(2,3)14-8-5-13(6-9-14)7-10-15(19)18-12-11-17-4/h5-6,8-9,17H,7,10-12H2,1-4H3,(H,18,19) |
| InChIKey | NKGYREPHMFDSSY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|