C14H23ClN2O2 — CID 119500056
4-(4-methoxyphenyl)-N-[2-(methylamino)ethyl]butanamide;hydrochloride (PubChem CID 119500056) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[2-(methylamino)ethyl]butanamide;hydrochloride.
| Compound Name | 4-(4-methoxyphenyl)-N-[2-(methylamino)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119500056 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[2-(methylamino)ethyl]butanamide;hydrochloride |
| SMILES | CNCCNC(=O)CCCc1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C14H22N2O2.ClH/c1-15-10-11-16-14(17)5-3-4-12-6-8-13(18-2)9-7-12;/h6-9,15H,3-5,10-11H2,1-2H3,(H,16,17);1H |
| InChIKey | QCYUCSYNYPWEHB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|