C28H42N4O3 — CID 24854364
N'-hydroxy-N-[3-[4-[(2-phenylphenyl)methylamino]butylamino]propyl]octanediamide (PubChem CID 24854364) has the molecular formula C28H42N4O3 and a molecular weight of 482.67 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[4-[(2-phenylphenyl)methylamino]butylamino]propyl]octanediamide.
| Compound Name | N'-hydroxy-N-[3-[4-[(2-phenylphenyl)methylamino]butylamino]propyl]octanediamide |
|---|---|
| PubChem CID | 24854364 |
| Molecular Formula | C28H42N4O3 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | N'-hydroxy-N-[3-[4-[(2-phenylphenyl)methylamino]butylamino]propyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)NCCCNCCCCNCc1ccccc1-c1ccccc1)NO |
| InChI | InChI=1S/C28H42N4O3/c33-27(17-6-1-2-7-18-28(34)32-35)31-22-12-21-29-19-10-11-20-30-23-25-15-8-9-16-26(25)24-13-4-3-5-14-24/h3-5,8-9,13-16,29-30,35H,1-2,6-7,10-12,17-23H2,(H,31,33)(H,32,34) |
| InChIKey | DBHQTFKGJUWNTQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|