C15H20N2O3 — CID 87214827
N-hydroxy-6-[[(Z)-3-phenylprop-2-enoyl]amino]hexanamide (PubChem CID 87214827) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-hydroxy-6-[[(Z)-3-phenylprop-2-enoyl]amino]hexanamide.
| Compound Name | N-hydroxy-6-[[(Z)-3-phenylprop-2-enoyl]amino]hexanamide |
|---|---|
| PubChem CID | 87214827 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-hydroxy-6-[[(Z)-3-phenylprop-2-enoyl]amino]hexanamide |
| SMILES | O=C(/C=C\c1ccccc1)NCCCCCC(=O)NO |
| InChI | InChI=1S/C15H20N2O3/c18-14(11-10-13-7-3-1-4-8-13)16-12-6-2-5-9-15(19)17-20/h1,3-4,7-8,10-11,20H,2,5-6,9,12H2,(H,16,18)(H,17,19)/b11-10- |
| InChIKey | NRWALYHECPWEAM-KHPPLWFESA-N |
| XLogP | 1.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|