C12H16N2O — CID 76948085
N-[2-(methylamino)ethyl]-3-phenylprop-2-enamide (PubChem CID 76948085) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3-phenylprop-2-enamide.
| Compound Name | N-[2-(methylamino)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 76948085 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3-phenylprop-2-enamide |
| SMILES | CNCCNC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C12H16N2O/c1-13-9-10-14-12(15)8-7-11-5-3-2-4-6-11/h2-8,13H,9-10H2,1H3,(H,14,15) |
| InChIKey | BNQHZOAPDFDBOM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|