C28H40N2O3Si2 — CID 76676980
N-[3-[[dimethyl-[3-(3-phenylprop-2-enoylamino)propyl]silyl]oxy-dimethylsilyl]propyl]-3-phenylprop-2-enamide (PubChem CID 76676980) has the molecular formula C28H40N2O3Si2 and a molecular weight of 508.81 g/mol. Its IUPAC name is N-[3-[[dimethyl-[3-(3-phenylprop-2-enoylamino)propyl]silyl]oxy-dimethylsilyl]propyl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-[[dimethyl-[3-(3-phenylprop-2-enoylamino)propyl]silyl]oxy-dimethylsilyl]propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 76676980 |
| Molecular Formula | C28H40N2O3Si2 |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | N-[3-[[dimethyl-[3-(3-phenylprop-2-enoylamino)propyl]silyl]oxy-dimethylsilyl]propyl]-3-phenylprop-2-enamide |
| SMILES | C[Si](C)(CCCNC(=O)C=Cc1ccccc1)O[Si](C)(C)CCCNC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C28H40N2O3Si2/c1-34(2,23-11-21-29-27(31)19-17-25-13-7-5-8-14-25)33-35(3,4)24-12-22-30-28(32)20-18-26-15-9-6-10-16-26/h5-10,13-20H,11-12,21-24H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | PEORXFIGPQCNDG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|