C18H32N2O7Si2 — CID 20725140
(E)-4-[3-[[3-[[(E)-3-carboxyprop-2-enoyl]amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-4-oxobut-2-enoic acid (PubChem CID 20725140) has the molecular formula C18H32N2O7Si2 and a molecular weight of 444.63 g/mol. Its IUPAC name is (E)-4-[3-[[3-[[(E)-3-carboxyprop-2-enoyl]amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[[3-[[(E)-3-carboxyprop-2-enoyl]amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 20725140 |
| Molecular Formula | C18H32N2O7Si2 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (E)-4-[3-[[3-[[(E)-3-carboxyprop-2-enoyl]amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-4-oxobut-2-enoic acid |
| SMILES | C[Si](C)(CCCNC(=O)/C=C/C(=O)O)O[Si](C)(C)CCCNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H32N2O7Si2/c1-28(2,13-5-11-19-15(21)7-9-17(23)24)27-29(3,4)14-6-12-20-16(22)8-10-18(25)26/h7-10H,5-6,11-14H2,1-4H3,(H,19,21)(H,20,22)(H,23,24)(H,25,26)/b9-7+,10-8+ |
| InChIKey | YQOHKDOCWLCBGM-FIFLTTCUSA-N |
| XLogP | 1.71 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|