C16H24N2O6 — CID 54461920
4-[8-(3-carboxyprop-2-enoylamino)octylamino]-4-oxobut-2-enoic acid (PubChem CID 54461920) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[8-(3-carboxyprop-2-enoylamino)octylamino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[8-(3-carboxyprop-2-enoylamino)octylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54461920 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[8-(3-carboxyprop-2-enoylamino)octylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NCCCCCCCCNC(=O)C=CC(=O)O |
| InChI | InChI=1S/C16H24N2O6/c19-13(7-9-15(21)22)17-11-5-3-1-2-4-6-12-18-14(20)8-10-16(23)24/h7-10H,1-6,11-12H2,(H,17,19)(H,18,20)(H,21,22)(H,23,24) |
| InChIKey | XCEPONXXVWSGJI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|