C14H23NO3 — CID 101277205
(E)-4-[[(E)-dec-8-enyl]amino]-4-oxobut-2-enoic acid (PubChem CID 101277205) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (E)-4-[[(E)-dec-8-enyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(E)-dec-8-enyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 101277205 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (E)-4-[[(E)-dec-8-enyl]amino]-4-oxobut-2-enoic acid |
| SMILES | C/C=C/CCCCCCCNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H23NO3/c1-2-3-4-5-6-7-8-9-12-15-13(16)10-11-14(17)18/h2-3,10-11H,4-9,12H2,1H3,(H,15,16)(H,17,18)/b3-2+,11-10+ |
| InChIKey | QTFIWKWOINEMID-MYPVRGOXSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|