C28H52N2O2 — CID 101279982
N,N'-bis[(E)-undec-9-enyl]hexanediamide (PubChem CID 101279982) has the molecular formula C28H52N2O2 and a molecular weight of 448.74 g/mol. Its IUPAC name is N,N'-bis[(E)-undec-9-enyl]hexanediamide.
| Compound Name | N,N'-bis[(E)-undec-9-enyl]hexanediamide |
|---|---|
| PubChem CID | 101279982 |
| Molecular Formula | C28H52N2O2 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.40 |
| IUPAC Name | N,N'-bis[(E)-undec-9-enyl]hexanediamide |
| SMILES | C/C=C/CCCCCCCCNC(=O)CCCCC(=O)NCCCCCCCC/C=C/C |
| InChI | InChI=1S/C28H52N2O2/c1-3-5-7-9-11-13-15-17-21-25-29-27(31)23-19-20-24-28(32)30-26-22-18-16-14-12-10-8-6-4-2/h3-6H,7-26H2,1-2H3,(H,29,31)(H,30,32)/b5-3+,6-4+ |
| InChIKey | AJHQZHWOCBHGIR-GGWOSOGESA-N |
| XLogP | 7.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|