C26H48N2O2 — CID 101279972
N,N'-bis[(E)-dec-8-enyl]hexanediamide (PubChem CID 101279972) has the molecular formula C26H48N2O2 and a molecular weight of 420.68 g/mol. Its IUPAC name is N,N'-bis[(E)-dec-8-enyl]hexanediamide.
| Compound Name | N,N'-bis[(E)-dec-8-enyl]hexanediamide |
|---|---|
| PubChem CID | 101279972 |
| Molecular Formula | C26H48N2O2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.37 |
| IUPAC Name | N,N'-bis[(E)-dec-8-enyl]hexanediamide |
| SMILES | C/C=C/CCCCCCCNC(=O)CCCCC(=O)NCCCCCCC/C=C/C |
| InChI | InChI=1S/C26H48N2O2/c1-3-5-7-9-11-13-15-19-23-27-25(29)21-17-18-22-26(30)28-24-20-16-14-12-10-8-6-4-2/h3-6H,7-24H2,1-2H3,(H,27,29)(H,28,30)/b5-3+,6-4+ |
| InChIKey | PXKLLGFFNWYQLD-GGWOSOGESA-N |
| XLogP | 6.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|