C8H13NO4 — CID 106840396
(E)-4-(4-hydroxybutylamino)-4-oxobut-2-enoic acid (PubChem CID 106840396) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is (E)-4-(4-hydroxybutylamino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(4-hydroxybutylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 106840396 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (E)-4-(4-hydroxybutylamino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NCCCCO |
| InChI | InChI=1S/C8H13NO4/c10-6-2-1-5-9-7(11)3-4-8(12)13/h3-4,10H,1-2,5-6H2,(H,9,11)(H,12,13)/b4-3+ |
| InChIKey | GFYSUIJIYJKGLR-ONEGZZNKSA-N |
| XLogP | -0.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|