C10H17LaNO3 — CID 174988746
(Z)-4-(hexylamino)-4-oxobut-2-enoic acid;lanthanum (PubChem CID 174988746) has the molecular formula C10H17LaNO3 and a molecular weight of 338.16 g/mol. Its IUPAC name is (Z)-4-(hexylamino)-4-oxobut-2-enoic acid;lanthanum.
| Compound Name | (Z)-4-(hexylamino)-4-oxobut-2-enoic acid;lanthanum |
|---|---|
| PubChem CID | 174988746 |
| Molecular Formula | C10H17LaNO3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (Z)-4-(hexylamino)-4-oxobut-2-enoic acid;lanthanum |
| SMILES | CCCCCCNC(=O)/C=C\C(=O)O.[La] |
| InChI | InChI=1S/C10H17NO3.La/c1-2-3-4-5-8-11-9(12)6-7-10(13)14;/h6-7H,2-5,8H2,1H3,(H,11,12)(H,13,14);/b7-6-; |
| InChIKey | YFMRRSYXYGIQFV-NAFXZHHSSA-N |
| XLogP | 1.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|