C6H8FNO3 — CID 130160499
(E)-4-(2-fluoroethylamino)-4-oxobut-2-enoic acid (PubChem CID 130160499) has the molecular formula C6H8FNO3 and a molecular weight of 161.13 g/mol. Its IUPAC name is (E)-4-(2-fluoroethylamino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2-fluoroethylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 130160499 |
| Molecular Formula | C6H8FNO3 |
| Molecular Weight | 161.13 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | (E)-4-(2-fluoroethylamino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NCCF |
| InChI | InChI=1S/C6H8FNO3/c7-3-4-8-5(9)1-2-6(10)11/h1-2H,3-4H2,(H,8,9)(H,10,11)/b2-1+ |
| InChIKey | VPQKSZGCKZVYDI-OWOJBTEDSA-N |
| XLogP | -0.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|