C9H15FN2O3 — CID 155700047
ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid (PubChem CID 155700047) has the molecular formula C9H15FN2O3 and a molecular weight of 218.23 g/mol. Its IUPAC name is ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid.
| Compound Name | ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid |
|---|---|
| PubChem CID | 155700047 |
| Molecular Formula | C9H15FN2O3 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid |
| SMILES | CC.[H]/N=C(/C=C\C(=O)NCCF)C(=O)O |
| InChI | InChI=1S/C7H9FN2O3.C2H6/c8-3-4-10-6(11)2-1-5(9)7(12)13;1-2/h1-2,9H,3-4H2,(H,10,11)(H,12,13);1-2H3/b2-1-,9-5-; |
| InChIKey | XMDXEBBXZBIMKY-FPKSYKQCSA-N |
| XLogP | 0.76 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|