About ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid
ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid (PubChem CID 155700047) has the molecular formula C9H15FN2O3
and a molecular weight of 218.23 g/mol. Its IUPAC name is ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid.
Molecular Properties
| Compound Name | ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid |
| PubChem CID | 155700047 |
| Molecular Formula | C9H15FN2O3 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid |
| SMILES | CC.[H]/N=C(/C=C\C(=O)NCCF)C(=O)O |
| InChI | InChI=1S/C7H9FN2O3.C2H6/c8-3-4-10-6(11)2-1-5(9)7(12)13;1-2/h1-2,9H,3-4H2,(H,10,11)(H,12,13);1-2H3/b2-1-,9-5-; |
| InChIKey | XMDXEBBXZBIMKY-FPKSYKQCSA-N |
| XLogP | 0.76 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid?
The IUPAC name of ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid (CID 155700047) is ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid.
What is the SMILES notation for ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid?
The canonical SMILES for ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid is CC.[H]/N=C(/C=C\C(=O)NCCF)C(=O)O.
What is the InChIKey of ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid?
The InChIKey is XMDXEBBXZBIMKY-FPKSYKQCSA-N. The full InChI is InChI=1S/C7H9FN2O3.C2H6/c8-3-4-10-6(11)2-1-5(9)7(12)13;1-2/h1-2,9H,3-4H2,(H,10,11)(H,12,13);1-2H3/b2-1-,9-5-;.
What are the key properties of ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid?
ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid has a molecular weight of 218.23 g/mol, XLogP of 0.76, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-5-(2-fluoroethylamino)-2-imino-5-oxopent-3-enoic acid is sourced from PubChem (CID 155700047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).