C8H16N4O2 — CID 86151646
N,N'-bis(2-aminoethyl)but-2-enediamide (PubChem CID 86151646) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is N,N'-bis(2-aminoethyl)but-2-enediamide.
| Compound Name | N,N'-bis(2-aminoethyl)but-2-enediamide |
|---|---|
| PubChem CID | 86151646 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N,N'-bis(2-aminoethyl)but-2-enediamide |
| SMILES | NCCNC(=O)C=CC(=O)NCCN |
| InChI | InChI=1S/C8H16N4O2/c9-3-5-11-7(13)1-2-8(14)12-6-4-10/h1-2H,3-6,9-10H2,(H,11,13)(H,12,14) |
| InChIKey | YMDLYODQLMSZCA-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|