C8H20ClN3O — CID 173056449
N-(2-aminoethyl)prop-2-enamide;N,N-dimethylmethanamine;hydrochloride (PubChem CID 173056449) has the molecular formula C8H20ClN3O and a molecular weight of 209.72 g/mol. Its IUPAC name is N-(2-aminoethyl)prop-2-enamide;N,N-dimethylmethanamine;hydrochloride.
| Compound Name | N-(2-aminoethyl)prop-2-enamide;N,N-dimethylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 173056449 |
| Molecular Formula | C8H20ClN3O |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | N-(2-aminoethyl)prop-2-enamide;N,N-dimethylmethanamine;hydrochloride |
| SMILES | C=CC(=O)NCCN.CN(C)C.Cl |
| InChI | InChI=1S/C5H10N2O.C3H9N.ClH/c1-2-5(8)7-4-3-6;1-4(2)3;/h2H,1,3-4,6H2,(H,7,8);1-3H3;1H |
| InChIKey | KNPYNEPWCOLXMX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|