C11H22ClN3O2 — CID 173080700
N-[3-(dimethylamino)propyl]prop-2-enamide;prop-2-enamide;hydrochloride (PubChem CID 173080700) has the molecular formula C11H22ClN3O2 and a molecular weight of 263.77 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]prop-2-enamide;prop-2-enamide;hydrochloride.
| Compound Name | N-[3-(dimethylamino)propyl]prop-2-enamide;prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 173080700 |
| Molecular Formula | C11H22ClN3O2 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]prop-2-enamide;prop-2-enamide;hydrochloride |
| SMILES | C=CC(=O)NCCCN(C)C.C=CC(N)=O.Cl |
| InChI | InChI=1S/C8H16N2O.C3H5NO.ClH/c1-4-8(11)9-6-5-7-10(2)3;1-2-3(4)5;/h4H,1,5-7H2,2-3H3,(H,9,11);2H,1H2,(H2,4,5);1H |
| InChIKey | BEEFMYJFYFUYLI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|