C18H37N4O2+ — CID 175755238
N-[3-(dimethylamino)propyl]prop-2-enamide;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 175755238) has the molecular formula C18H37N4O2+ and a molecular weight of 341.52 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]prop-2-enamide;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | N-[3-(dimethylamino)propyl]prop-2-enamide;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 175755238 |
| Molecular Formula | C18H37N4O2+ |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | N-[3-(dimethylamino)propyl]prop-2-enamide;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C.C=CC(=O)NCCCN(C)C |
| InChI | InChI=1S/C10H20N2O.C8H16N2O/c1-9(2)10(13)11-7-6-8-12(3,4)5;1-4-8(11)9-6-5-7-10(2)3/h1,6-8H2,2-5H3;4H,1,5-7H2,2-3H3,(H,9,11)/p+1 |
| InChIKey | SIBPRRATURGEDO-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|