C10H21ClN2O — CID 177404233
trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium chloride (PubChem CID 177404233) has the molecular formula C10H21ClN2O and a molecular weight of 220.74 g/mol. Its IUPAC name is trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium chloride.
| Compound Name | trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium chloride |
|---|---|
| PubChem CID | 177404233 |
| Molecular Formula | C10H21ClN2O |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium chloride |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C10H20N2O.ClH/c1-9(2)10(13)11-7-6-8-12(3,4)5;/h1,6-8H2,2-5H3;1H |
| InChIKey | UZNHKBFIBYXPDV-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|