C15H32N3O6S+ — CID 174782093
azane;methoxysulfonyl 2-methylprop-2-enoate;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 174782093) has the molecular formula C15H32N3O6S+ and a molecular weight of 382.50 g/mol. Its IUPAC name is azane;methoxysulfonyl 2-methylprop-2-enoate;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | azane;methoxysulfonyl 2-methylprop-2-enoate;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 174782093 |
| Molecular Formula | C15H32N3O6S+ |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | azane;methoxysulfonyl 2-methylprop-2-enoate;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C.C=C(C)C(=O)OS(=O)(=O)OC.N |
| InChI | InChI=1S/C10H20N2O.C5H8O5S.H3N/c1-9(2)10(13)11-7-6-8-12(3,4)5;1-4(2)5(6)10-11(7,8)9-3;/h1,6-8H2,2-5H3;1H2,2-3H3;1H3/p+1 |
| InChIKey | IGWCOFJPHYCCPV-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|