C9H20N2O5S — CID 118388929
hydrogen sulfate;trimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium (PubChem CID 118388929) has the molecular formula C9H20N2O5S and a molecular weight of 268.33 g/mol. Its IUPAC name is hydrogen sulfate;trimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium.
| Compound Name | hydrogen sulfate;trimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 118388929 |
| Molecular Formula | C9H20N2O5S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | hydrogen sulfate;trimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium |
| SMILES | C=C(C)C(=O)NCC[N+](C)(C)C.O=S(=O)([O-])O |
| InChI | InChI=1S/C9H18N2O.H2O4S/c1-8(2)9(12)10-6-7-11(3,4)5;1-5(2,3)4/h1,6-7H2,2-5H3;(H2,1,2,3,4) |
| InChIKey | LUOAIQPXXGAEDU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|