C24H46N4O6S — CID 175311291
bis(trimethyl-[5-(2-methylprop-2-enoylamino)pent-2-enyl]azanium);sulfate (PubChem CID 175311291) has the molecular formula C24H46N4O6S and a molecular weight of 518.72 g/mol. Its IUPAC name is bis(trimethyl-[5-(2-methylprop-2-enoylamino)pent-2-enyl]azanium);sulfate.
| Compound Name | bis(trimethyl-[5-(2-methylprop-2-enoylamino)pent-2-enyl]azanium);sulfate |
|---|---|
| PubChem CID | 175311291 |
| Molecular Formula | C24H46N4O6S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | bis(trimethyl-[5-(2-methylprop-2-enoylamino)pent-2-enyl]azanium);sulfate |
| SMILES | C=C(C)C(=O)NCCC=CC[N+](C)(C)C.C=C(C)C(=O)NCCC=CC[N+](C)(C)C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C12H22N2O.H2O4S/c2*1-11(2)12(15)13-9-7-6-8-10-14(3,4)5;1-5(2,3)4/h2*6,8H,1,7,9-10H2,2-5H3;(H2,1,2,3,4) |
| InChIKey | QVXUJUMCPOJGJN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|