C9H18N2O2 — CID 87182014
N,N-dimethyl-3-(2-methylprop-2-enoylamino)propan-1-amine oxide (PubChem CID 87182014) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylprop-2-enoylamino)propan-1-amine oxide.
| Compound Name | N,N-dimethyl-3-(2-methylprop-2-enoylamino)propan-1-amine oxide |
|---|---|
| PubChem CID | 87182014 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N,N-dimethyl-3-(2-methylprop-2-enoylamino)propan-1-amine oxide |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C9H18N2O2/c1-8(2)9(12)10-6-5-7-11(3,4)13/h1,5-7H2,2-4H3,(H,10,12) |
| InChIKey | GOXLPGTYVYTZHW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|