C19H32N4O — CID 166886440
2-methyl-N-[3-[3-[3-(3-methylbuta-1,3-dien-2-ylamino)propylamino]buta-1,3-dien-2-ylamino]propyl]prop-2-enamide (PubChem CID 166886440) has the molecular formula C19H32N4O and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-methyl-N-[3-[3-[3-(3-methylbuta-1,3-dien-2-ylamino)propylamino]buta-1,3-dien-2-ylamino]propyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3-[3-[3-(3-methylbuta-1,3-dien-2-ylamino)propylamino]buta-1,3-dien-2-ylamino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 166886440 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 2-methyl-N-[3-[3-[3-(3-methylbuta-1,3-dien-2-ylamino)propylamino]buta-1,3-dien-2-ylamino]propyl]prop-2-enamide |
| SMILES | C=C(C)C(=C)NCCCNC(=C)C(=C)NCCCNC(=O)C(=C)C |
| InChI | InChI=1S/C19H32N4O/c1-14(2)16(5)20-10-8-11-21-17(6)18(7)22-12-9-13-23-19(24)15(3)4/h20-22H,1,3,5-13H2,2,4H3,(H,23,24) |
| InChIKey | NDZVZVQDGUCNLK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|