C10H16N2O5 — CID 87206701
2-[3-(2-methylprop-2-enoylamino)propylamino]propanedioic acid (PubChem CID 87206701) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-[3-(2-methylprop-2-enoylamino)propylamino]propanedioic acid.
| Compound Name | 2-[3-(2-methylprop-2-enoylamino)propylamino]propanedioic acid |
|---|---|
| PubChem CID | 87206701 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-[3-(2-methylprop-2-enoylamino)propylamino]propanedioic acid |
| SMILES | C=C(C)C(=O)NCCCNC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O5/c1-6(2)8(13)12-5-3-4-11-7(9(14)15)10(16)17/h7,11H,1,3-5H2,2H3,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | QONMOPDSLPNJPJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|