C24H47NO — CID 22336363
N-icosyl-2-methylprop-2-enamide (PubChem CID 22336363) has the molecular formula C24H47NO and a molecular weight of 365.65 g/mol. Its IUPAC name is N-icosyl-2-methylprop-2-enamide.
| Compound Name | N-icosyl-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 22336363 |
| Molecular Formula | C24H47NO |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.37 |
| IUPAC Name | N-icosyl-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C24H47NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-24(26)23(2)3/h2,4-22H2,1,3H3,(H,25,26) |
| InChIKey | XCDJUQPITKVQKB-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|