C17H35N2O+ — CID 87318996
dimethyl-[3-(2-methylprop-2-enoylamino)propyl]-octylazanium (PubChem CID 87318996) has the molecular formula C17H35N2O+ and a molecular weight of 283.48 g/mol. Its IUPAC name is dimethyl-[3-(2-methylprop-2-enoylamino)propyl]-octylazanium.
| Compound Name | dimethyl-[3-(2-methylprop-2-enoylamino)propyl]-octylazanium |
|---|---|
| PubChem CID | 87318996 |
| Molecular Formula | C17H35N2O+ |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | dimethyl-[3-(2-methylprop-2-enoylamino)propyl]-octylazanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CCCCCCCC |
| InChI | InChI=1S/C17H34N2O/c1-6-7-8-9-10-11-14-19(4,5)15-12-13-18-17(20)16(2)3/h2,6-15H2,1,3-5H3/p+1 |
| InChIKey | QTPBXRDPGAFYHO-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|