C25H50N4O7S2+2 — CID 146236857
3-[4-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]butylsulfonyloxysulfonyl]propyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 146236857) has the molecular formula C25H50N4O7S2+2 and a molecular weight of 582.83 g/mol. Its IUPAC name is 3-[4-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]butylsulfonyloxysulfonyl]propyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | 3-[4-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]butylsulfonyloxysulfonyl]propyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 146236857 |
| Molecular Formula | C25H50N4O7S2+2 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 3-[4-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]butylsulfonyloxysulfonyl]propyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CCCCS(=O)(=O)OS(=O)(=O)CCC[N+](C)(C)CCCNC(=O)C(=C)C |
| InChI | InChI=1S/C25H48N4O7S2/c1-22(2)24(30)26-14-11-17-28(5,6)16-9-10-20-37(32,33)36-38(34,35)21-13-19-29(7,8)18-12-15-27-25(31)23(3)4/h1,3,9-21H2,2,4-8H3/p+2 |
| InChIKey | PLETXTILSBEGCD-UHFFFAOYSA-P |
| XLogP | 1.15 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|