C16H33N4O2+ — CID 89186109
[2-[3-(dimethylamino)propylamino]-2-oxoethyl]-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 89186109) has the molecular formula C16H33N4O2+ and a molecular weight of 313.47 g/mol. Its IUPAC name is [2-[3-(dimethylamino)propylamino]-2-oxoethyl]-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | [2-[3-(dimethylamino)propylamino]-2-oxoethyl]-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 89186109 |
| Molecular Formula | C16H33N4O2+ |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | [2-[3-(dimethylamino)propylamino]-2-oxoethyl]-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CC(=O)NCCCN(C)C |
| InChI | InChI=1S/C16H32N4O2/c1-14(2)16(22)18-10-8-12-20(5,6)13-15(21)17-9-7-11-19(3)4/h1,7-13H2,2-6H3,(H-,17,18,21,22)/p+1 |
| InChIKey | JNPDHXRIHFZXGY-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|