C12H24N2O — CID 91268844
N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-1-ene (PubChem CID 91268844) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-1-ene.
| Compound Name | N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-1-ene |
|---|---|
| PubChem CID | 91268844 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;prop-1-ene |
| SMILES | C=C(C)C(=O)NCCCN(C)C.C=CC |
| InChI | InChI=1S/C9H18N2O.C3H6/c1-8(2)9(12)10-6-5-7-11(3)4;1-3-2/h1,5-7H2,2-4H3,(H,10,12);3H,1H2,2H3 |
| InChIKey | PNDTVLWSQHQXEN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|