C15H29N3O2 — CID 139534789
N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;2,3-dimethylbut-2-enamide (PubChem CID 139534789) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;2,3-dimethylbut-2-enamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;2,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 139534789 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-methylprop-2-enamide;2,3-dimethylbut-2-enamide |
| SMILES | C=C(C)C(=O)NCCCN(C)C.CC(C)=C(C)C(N)=O |
| InChI | InChI=1S/C9H18N2O.C6H11NO/c1-8(2)9(12)10-6-5-7-11(3)4;1-4(2)5(3)6(7)8/h1,5-7H2,2-4H3,(H,10,12);1-3H3,(H2,7,8) |
| InChIKey | CQRQQDCLXRHPSM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|