C13H25NO — CID 174789419
N-butyl-2-methylprop-2-enamide;2-methylbut-2-ene (PubChem CID 174789419) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N-butyl-2-methylprop-2-enamide;2-methylbut-2-ene.
| Compound Name | N-butyl-2-methylprop-2-enamide;2-methylbut-2-ene |
|---|---|
| PubChem CID | 174789419 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-butyl-2-methylprop-2-enamide;2-methylbut-2-ene |
| SMILES | C=C(C)C(=O)NCCCC.CC=C(C)C |
| InChI | InChI=1S/C8H15NO.C5H10/c1-4-5-6-9-8(10)7(2)3;1-4-5(2)3/h2,4-6H2,1,3H3,(H,9,10);4H,1-3H3 |
| InChIKey | CHYIGCWONXOUDI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|